Urolithin B (1139-83-9) Chaw tsim tshuaj paus Hoobkas

Urolithin B

Kaum ib hlis 9, 2020

Urolithin BSpecifications

Lub npe: Urolithin B
Tshuaj Lub Npe: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-ib
CAS: 1139-83-9
Tshuaj Siv Mis: C13H8O3
Molecular phaus: 212.2 g / mol
xim:  Dawb hmoov
Qhov tseem ceeb hauv InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Code: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolithin B tuaj yeem txhim kho mitochondrial thiab cov leeg ua haujlwm.

Urolithin B tuaj yeem txhim kho cov leeg pob txha thiab lub zog thaum lub caij laus.

daim ntawv thov: Urolithin B yog lub plab hnyuv plab zom zaub mov ntawm ellagitannis thiab ua kom pom cov khoom muaj zog tiv thaiv tua hluav taws thiab cov khoom ua kom muaj zog nyob ntawm seb cov kab mob thiab kev ua haujlwm zoo li cas. Urolithin B tseem tuaj yeem tso tawm estrogenic thiab / lossis kev ua haujlwm los tiv thaiv estrogen.
Dej Cev: Yooj yim soluble hauv N, N-dimethylformamide thiab dimethylmethylene. Sulfone, ib nyuag soluble hauv methanol, ethanol, thiab ethyl acetate
Cia Temp: Hygroscopic, -20 ° C Lub Freezer, Nyob rau hauv chaw huab cua
Cov Teeb Meem Them: Shipped hauv ambient kub li tsis muaj tshuaj lom neeg. Cov khoom no ruaj khov txaus rau ob peb lub lis piam thaum cov khoom qub thiab sij hawm siv hauv kev lis kev cai.